C9H3BrF6O — CID 134638660
2-bromo-3,4-bis(trifluoromethyl)benzaldehyde (PubChem CID 134638660) has the molecular formula C9H3BrF6O and a molecular weight of 321.01 g/mol. Its IUPAC name is 2-bromo-3,4-bis(trifluoromethyl)benzaldehyde.
| Compound Name | 2-bromo-3,4-bis(trifluoromethyl)benzaldehyde |
|---|---|
| PubChem CID | 134638660 |
| Molecular Formula | C9H3BrF6O |
| Molecular Weight | 321.01 g/mol |
| Exact Mass | 319.93 |
| IUPAC Name | 2-bromo-3,4-bis(trifluoromethyl)benzaldehyde |
| SMILES | O=Cc1ccc(C(F)(F)F)c(C(F)(F)F)c1Br |
| InChI | InChI=1S/C9H3BrF6O/c10-7-4(3-17)1-2-5(8(11,12)13)6(7)9(14,15)16/h1-3H |
| InChIKey | ZEQQREGDQQZSQE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.01 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|