About 2-methoxy-3,4-bis(trifluoromethyl)benzaldehyde
2-methoxy-3,4-bis(trifluoromethyl)benzaldehyde (PubChem CID 134640560) has the molecular formula C10H6F6O2
and a molecular weight of 272.14 g/mol. Its IUPAC name is 2-methoxy-3,4-bis(trifluoromethyl)benzaldehyde.
Molecular Properties
| Compound Name | 2-methoxy-3,4-bis(trifluoromethyl)benzaldehyde |
| PubChem CID | 134640560 |
| Molecular Formula | C10H6F6O2 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 2-methoxy-3,4-bis(trifluoromethyl)benzaldehyde |
| SMILES | COc1c(C=O)ccc(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C10H6F6O2/c1-18-8-5(4-17)2-3-6(9(11,12)13)7(8)10(14,15)16/h2-4H,1H3 |
| InChIKey | XZBRSCUPKYPYIS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-3,4-bis(trifluoromethyl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-3,4-bis(trifluoromethyl)benzaldehyde?
The IUPAC name of 2-methoxy-3,4-bis(trifluoromethyl)benzaldehyde (CID 134640560) is 2-methoxy-3,4-bis(trifluoromethyl)benzaldehyde.
What is the SMILES notation for 2-methoxy-3,4-bis(trifluoromethyl)benzaldehyde?
The canonical SMILES for 2-methoxy-3,4-bis(trifluoromethyl)benzaldehyde is COc1c(C=O)ccc(C(F)(F)F)c1C(F)(F)F.
What is the InChIKey of 2-methoxy-3,4-bis(trifluoromethyl)benzaldehyde?
The InChIKey is XZBRSCUPKYPYIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F6O2/c1-18-8-5(4-17)2-3-6(9(11,12)13)7(8)10(14,15)16/h2-4H,1H3.
What are the key properties of 2-methoxy-3,4-bis(trifluoromethyl)benzaldehyde?
2-methoxy-3,4-bis(trifluoromethyl)benzaldehyde has a molecular weight of 272.14 g/mol, XLogP of 3.55, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3,4-bis(trifluoromethyl)benzaldehyde is sourced from PubChem (CID 134640560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).