C10H6F6O2 — CID 134640560
2-methoxy-3,4-bis(trifluoromethyl)benzaldehyde (PubChem CID 134640560) has the molecular formula C10H6F6O2 and a molecular weight of 272.14 g/mol. Its IUPAC name is 2-methoxy-3,4-bis(trifluoromethyl)benzaldehyde.
| Compound Name | 2-methoxy-3,4-bis(trifluoromethyl)benzaldehyde |
|---|---|
| PubChem CID | 134640560 |
| Molecular Formula | C10H6F6O2 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 2-methoxy-3,4-bis(trifluoromethyl)benzaldehyde |
| SMILES | COc1c(C=O)ccc(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C10H6F6O2/c1-18-8-5(4-17)2-3-6(9(11,12)13)7(8)10(14,15)16/h2-4H,1H3 |
| InChIKey | XZBRSCUPKYPYIS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|