C11H10F6N2O3 — CID 162037487
2,3-bis(trifluoromethyl)benzaldehyde;methyl N-aminocarbamate (PubChem CID 162037487) has the molecular formula C11H10F6N2O3 and a molecular weight of 332.20 g/mol. Its IUPAC name is 2,3-bis(trifluoromethyl)benzaldehyde;methyl N-aminocarbamate.
| Compound Name | 2,3-bis(trifluoromethyl)benzaldehyde;methyl N-aminocarbamate |
|---|---|
| PubChem CID | 162037487 |
| Molecular Formula | C11H10F6N2O3 |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 2,3-bis(trifluoromethyl)benzaldehyde;methyl N-aminocarbamate |
| SMILES | COC(=O)NN.O=Cc1cccc(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C9H4F6O.C2H6N2O2/c10-8(11,12)6-3-1-2-5(4-16)7(6)9(13,14)15;1-6-2(5)4-3/h1-4H;3H2,1H3,(H,4,5) |
| InChIKey | YWVLDDBKMLTEMK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|