C19H18N2 — CID 174990680
4-methyl-2,6-diphenylbenzene-1,3-diamine (PubChem CID 174990680) has the molecular formula C19H18N2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 4-methyl-2,6-diphenylbenzene-1,3-diamine.
| Compound Name | 4-methyl-2,6-diphenylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 174990680 |
| Molecular Formula | C19H18N2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 4-methyl-2,6-diphenylbenzene-1,3-diamine |
| SMILES | Cc1cc(-c2ccccc2)c(N)c(-c2ccccc2)c1N |
| InChI | InChI=1S/C19H18N2/c1-13-12-16(14-8-4-2-5-9-14)19(21)17(18(13)20)15-10-6-3-7-11-15/h2-12H,20-21H2,1H3 |
| InChIKey | YXNUIFSFGMQNSX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|