C14H10N4O2 — CID 141306256
3,4-diisocyanato-6-phenylbenzene-1,2-diamine (PubChem CID 141306256) has the molecular formula C14H10N4O2 and a molecular weight of 266.26 g/mol. Its IUPAC name is 3,4-diisocyanato-6-phenylbenzene-1,2-diamine.
| Compound Name | 3,4-diisocyanato-6-phenylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 141306256 |
| Molecular Formula | C14H10N4O2 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 3,4-diisocyanato-6-phenylbenzene-1,2-diamine |
| SMILES | Nc1c(-c2ccccc2)cc(N=C=O)c(N=C=O)c1N |
| InChI | InChI=1S/C14H10N4O2/c15-12-10(9-4-2-1-3-5-9)6-11(17-7-19)14(13(12)16)18-8-20/h1-6H,15-16H2 |
| InChIKey | YIRSCQHCKKCBFZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|