About 2-isocyanato-3,4-diphenylfuran
2-isocyanato-3,4-diphenylfuran (PubChem CID 12587784) has the molecular formula C17H11NO2
and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-isocyanato-3,4-diphenylfuran.
Molecular Properties
| Compound Name | 2-isocyanato-3,4-diphenylfuran |
| PubChem CID | 12587784 |
| Molecular Formula | C17H11NO2 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-isocyanato-3,4-diphenylfuran |
| SMILES | O=C=Nc1occ(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C17H11NO2/c19-12-18-17-16(14-9-5-2-6-10-14)15(11-20-17)13-7-3-1-4-8-13/h1-11H |
| InChIKey | FIKAELDYMMEDFZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 42.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyanato-3,4-diphenylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyanato-3,4-diphenylfuran?
The IUPAC name of 2-isocyanato-3,4-diphenylfuran (CID 12587784) is 2-isocyanato-3,4-diphenylfuran.
What is the SMILES notation for 2-isocyanato-3,4-diphenylfuran?
The canonical SMILES for 2-isocyanato-3,4-diphenylfuran is O=C=Nc1occ(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 2-isocyanato-3,4-diphenylfuran?
The InChIKey is FIKAELDYMMEDFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11NO2/c19-12-18-17-16(14-9-5-2-6-10-14)15(11-20-17)13-7-3-1-4-8-13/h1-11H.
What are the key properties of 2-isocyanato-3,4-diphenylfuran?
2-isocyanato-3,4-diphenylfuran has a molecular weight of 261.28 g/mol, XLogP of 4.58, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyanato-3,4-diphenylfuran is sourced from PubChem (CID 12587784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).