About 2-bromo-3,4-diphenylfuran
2-bromo-3,4-diphenylfuran (PubChem CID 141482587) has the molecular formula C16H11BrO
and a molecular weight of 299.17 g/mol. Its IUPAC name is 2-bromo-3,4-diphenylfuran.
Molecular Properties
| Compound Name | 2-bromo-3,4-diphenylfuran |
| PubChem CID | 141482587 |
| Molecular Formula | C16H11BrO |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | 2-bromo-3,4-diphenylfuran |
| SMILES | Brc1occ(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C16H11BrO/c17-16-15(13-9-5-2-6-10-13)14(11-18-16)12-7-3-1-4-8-12/h1-11H |
| InChIKey | NYDPRFWWKYUVFP-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-3,4-diphenylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3,4-diphenylfuran?
The IUPAC name of 2-bromo-3,4-diphenylfuran (CID 141482587) is 2-bromo-3,4-diphenylfuran.
What is the SMILES notation for 2-bromo-3,4-diphenylfuran?
The canonical SMILES for 2-bromo-3,4-diphenylfuran is Brc1occ(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 2-bromo-3,4-diphenylfuran?
The InChIKey is NYDPRFWWKYUVFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11BrO/c17-16-15(13-9-5-2-6-10-13)14(11-18-16)12-7-3-1-4-8-12/h1-11H.
What are the key properties of 2-bromo-3,4-diphenylfuran?
2-bromo-3,4-diphenylfuran has a molecular weight of 299.17 g/mol, XLogP of 5.38, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3,4-diphenylfuran is sourced from PubChem (CID 141482587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).