About 2-isocyanato-1-methyl-3,4-diphenylbenzene
2-isocyanato-1-methyl-3,4-diphenylbenzene (PubChem CID 177311009) has the molecular formula C20H15NO
and a molecular weight of 285.35 g/mol. Its IUPAC name is 2-isocyanato-1-methyl-3,4-diphenylbenzene.
Molecular Properties
| Compound Name | 2-isocyanato-1-methyl-3,4-diphenylbenzene |
| PubChem CID | 177311009 |
| Molecular Formula | C20H15NO |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-isocyanato-1-methyl-3,4-diphenylbenzene |
| SMILES | Cc1ccc(-c2ccccc2)c(-c2ccccc2)c1N=C=O |
| InChI | InChI=1S/C20H15NO/c1-15-12-13-18(16-8-4-2-5-9-16)19(20(15)21-14-22)17-10-6-3-7-11-17/h2-13H,1H3 |
| InChIKey | LWHRKMLPIVIIPQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyanato-1-methyl-3,4-diphenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyanato-1-methyl-3,4-diphenylbenzene?
The IUPAC name of 2-isocyanato-1-methyl-3,4-diphenylbenzene (CID 177311009) is 2-isocyanato-1-methyl-3,4-diphenylbenzene.
What is the SMILES notation for 2-isocyanato-1-methyl-3,4-diphenylbenzene?
The canonical SMILES for 2-isocyanato-1-methyl-3,4-diphenylbenzene is Cc1ccc(-c2ccccc2)c(-c2ccccc2)c1N=C=O.
What is the InChIKey of 2-isocyanato-1-methyl-3,4-diphenylbenzene?
The InChIKey is LWHRKMLPIVIIPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15NO/c1-15-12-13-18(16-8-4-2-5-9-16)19(20(15)21-14-22)17-10-6-3-7-11-17/h2-13H,1H3.
What are the key properties of 2-isocyanato-1-methyl-3,4-diphenylbenzene?
2-isocyanato-1-methyl-3,4-diphenylbenzene has a molecular weight of 285.35 g/mol, XLogP of 5.30, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyanato-1-methyl-3,4-diphenylbenzene is sourced from PubChem (CID 177311009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).