C22H26N2O4 — CID 174970107
(Z)-2,3-bis[2-(aminomethyl)-6-ethylphenyl]but-2-enedioic acid (PubChem CID 174970107) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is (Z)-2,3-bis[2-(aminomethyl)-6-ethylphenyl]but-2-enedioic acid.
| Compound Name | (Z)-2,3-bis[2-(aminomethyl)-6-ethylphenyl]but-2-enedioic acid |
|---|---|
| PubChem CID | 174970107 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | (Z)-2,3-bis[2-(aminomethyl)-6-ethylphenyl]but-2-enedioic acid |
| SMILES | CCc1cccc(CN)c1/C(C(=O)O)=C(/C(=O)O)c1c(CC)cccc1CN |
| InChI | InChI=1S/C22H26N2O4/c1-3-13-7-5-9-15(11-23)17(13)19(21(25)26)20(22(27)28)18-14(4-2)8-6-10-16(18)12-24/h5-10H,3-4,11-12,23-24H2,1-2H3,(H,25,26)(H,27,28)/b20-19- |
| InChIKey | DXTXXSNJETZKBE-VXPUYCOJSA-N |
| XLogP | 2.81 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|