C11H14N2O2 — CID 70486014
2,6-diethylbenzoic acid;molecular nitrogen (PubChem CID 70486014) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 2,6-diethylbenzoic acid;molecular nitrogen.
| Compound Name | 2,6-diethylbenzoic acid;molecular nitrogen |
|---|---|
| PubChem CID | 70486014 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2,6-diethylbenzoic acid;molecular nitrogen |
| SMILES | CCc1cccc(CC)c1C(=O)O.N#N |
| InChI | InChI=1S/C11H14O2.N2/c1-3-8-6-5-7-9(4-2)10(8)11(12)13;1-2/h5-7H,3-4H2,1-2H3,(H,12,13); |
| InChIKey | AZWVNLZQAZNWED-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|