C12H16O2 — CID 23273842
(2,6-diethylphenyl) acetate (PubChem CID 23273842) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (2,6-diethylphenyl) acetate.
| Compound Name | (2,6-diethylphenyl) acetate |
|---|---|
| PubChem CID | 23273842 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (2,6-diethylphenyl) acetate |
| SMILES | CCc1cccc(CC)c1OC(C)=O |
| InChI | InChI=1S/C12H16O2/c1-4-10-7-6-8-11(5-2)12(10)14-9(3)13/h6-8H,4-5H2,1-3H3 |
| InChIKey | YFRVAXPDVOEZFI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|