C18H13I2N — CID 66868227
2,3-diiodo-N,N-diphenylaniline (PubChem CID 66868227) has the molecular formula C18H13I2N and a molecular weight of 497.12 g/mol. Its IUPAC name is 2,3-diiodo-N,N-diphenylaniline.
| Compound Name | 2,3-diiodo-N,N-diphenylaniline |
|---|---|
| PubChem CID | 66868227 |
| Molecular Formula | C18H13I2N |
| Molecular Weight | 497.12 g/mol |
| Exact Mass | 496.91 |
| IUPAC Name | 2,3-diiodo-N,N-diphenylaniline |
| SMILES | Ic1cccc(N(c2ccccc2)c2ccccc2)c1I |
| InChI | InChI=1S/C18H13I2N/c19-16-12-7-13-17(18(16)20)21(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-13H |
| InChIKey | DOOMPZOFYPSIJI-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.12 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|