C18H16IN3 — CID 165179719
N-(2-iodophenyl)-4,6-dimethyl-N-phenylpyrimidin-2-amine (PubChem CID 165179719) has the molecular formula C18H16IN3 and a molecular weight of 401.25 g/mol. Its IUPAC name is N-(2-iodophenyl)-4,6-dimethyl-N-phenylpyrimidin-2-amine.
| Compound Name | N-(2-iodophenyl)-4,6-dimethyl-N-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 165179719 |
| Molecular Formula | C18H16IN3 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | N-(2-iodophenyl)-4,6-dimethyl-N-phenylpyrimidin-2-amine |
| SMILES | Cc1cc(C)nc(N(c2ccccc2)c2ccccc2I)n1 |
| InChI | InChI=1S/C18H16IN3/c1-13-12-14(2)21-18(20-13)22(15-8-4-3-5-9-15)17-11-7-6-10-16(17)19/h3-12H,1-2H3 |
| InChIKey | VSNLWSSJYLIFPM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|