C14H16N4O3S — CID 21285450
1-(4,6-dimethylpyrimidin-2-yl)-3-methylsulfonyl-1-phenylurea (PubChem CID 21285450) has the molecular formula C14H16N4O3S and a molecular weight of 320.37 g/mol. Its IUPAC name is 1-(4,6-dimethylpyrimidin-2-yl)-3-methylsulfonyl-1-phenylurea.
| Compound Name | 1-(4,6-dimethylpyrimidin-2-yl)-3-methylsulfonyl-1-phenylurea |
|---|---|
| PubChem CID | 21285450 |
| Molecular Formula | C14H16N4O3S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 1-(4,6-dimethylpyrimidin-2-yl)-3-methylsulfonyl-1-phenylurea |
| SMILES | Cc1cc(C)nc(N(C(=O)NS(C)(=O)=O)c2ccccc2)n1 |
| InChI | InChI=1S/C14H16N4O3S/c1-10-9-11(2)16-13(15-10)18(12-7-5-4-6-8-12)14(19)17-22(3,20)21/h4-9H,1-3H3,(H,17,19) |
| InChIKey | VMNYJUBTAWBQBA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |