C15H12F5N3O — CID 91736105
N-(4,6-dimethylpyrimidin-2-yl)-2,2,3,3,3-pentafluoro-N-phenylpropanamide (PubChem CID 91736105) has the molecular formula C15H12F5N3O and a molecular weight of 345.27 g/mol. Its IUPAC name is N-(4,6-dimethylpyrimidin-2-yl)-2,2,3,3,3-pentafluoro-N-phenylpropanamide.
| Compound Name | N-(4,6-dimethylpyrimidin-2-yl)-2,2,3,3,3-pentafluoro-N-phenylpropanamide |
|---|---|
| PubChem CID | 91736105 |
| Molecular Formula | C15H12F5N3O |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N-(4,6-dimethylpyrimidin-2-yl)-2,2,3,3,3-pentafluoro-N-phenylpropanamide |
| SMILES | Cc1cc(C)nc(N(C(=O)C(F)(F)C(F)(F)F)c2ccccc2)n1 |
| InChI | InChI=1S/C15H12F5N3O/c1-9-8-10(2)22-13(21-9)23(11-6-4-3-5-7-11)12(24)14(16,17)15(18,19)20/h3-8H,1-2H3 |
| InChIKey | DLJMRZHECVMFKA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|