C12H12FN3O — CID 19893957
N-(4,6-dimethylpyrimidin-2-yl)-N-(3-fluorophenyl)hydroxylamine (PubChem CID 19893957) has the molecular formula C12H12FN3O and a molecular weight of 233.25 g/mol. Its IUPAC name is N-(4,6-dimethylpyrimidin-2-yl)-N-(3-fluorophenyl)hydroxylamine.
| Compound Name | N-(4,6-dimethylpyrimidin-2-yl)-N-(3-fluorophenyl)hydroxylamine |
|---|---|
| PubChem CID | 19893957 |
| Molecular Formula | C12H12FN3O |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | N-(4,6-dimethylpyrimidin-2-yl)-N-(3-fluorophenyl)hydroxylamine |
| SMILES | Cc1cc(C)nc(N(O)c2cccc(F)c2)n1 |
| InChI | InChI=1S/C12H12FN3O/c1-8-6-9(2)15-12(14-8)16(17)11-5-3-4-10(13)7-11/h3-7,17H,1-2H3 |
| InChIKey | KEOBDMBCRJJQCA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|