C24H19ClIN3 — CID 170123541
1-N-(2-chloro-6-methyl-4-pyridinyl)-3-N-iodo-1-N,3-N-diphenylbenzene-1,3-diamine (PubChem CID 170123541) has the molecular formula C24H19ClIN3 and a molecular weight of 511.79 g/mol. Its IUPAC name is 1-N-(2-chloro-6-methyl-4-pyridinyl)-3-N-iodo-1-N,3-N-diphenylbenzene-1,3-diamine.
| Compound Name | 1-N-(2-chloro-6-methyl-4-pyridinyl)-3-N-iodo-1-N,3-N-diphenylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 170123541 |
| Molecular Formula | C24H19ClIN3 |
| Molecular Weight | 511.79 g/mol |
| Exact Mass | 511.03 |
| IUPAC Name | 1-N-(2-chloro-6-methyl-4-pyridinyl)-3-N-iodo-1-N,3-N-diphenylbenzene-1,3-diamine |
| SMILES | Cc1cc(N(c2ccccc2)c2cccc(N(I)c3ccccc3)c2)cc(Cl)n1 |
| InChI | InChI=1S/C24H19ClIN3/c1-18-15-23(17-24(25)27-18)28(19-9-4-2-5-10-19)21-13-8-14-22(16-21)29(26)20-11-6-3-7-12-20/h2-17H,1H3 |
| InChIKey | JOXHIPXBKZUPIW-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.79 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|