C36H28ClN3 — CID 166853433
3-N-[3-(3-aminophenyl)phenyl]-5-chloro-1-N,1-N,3-N-triphenylbenzene-1,3-diamine (PubChem CID 166853433) has the molecular formula C36H28ClN3 and a molecular weight of 538.09 g/mol. Its IUPAC name is 3-N-[3-(3-aminophenyl)phenyl]-5-chloro-1-N,1-N,3-N-triphenylbenzene-1,3-diamine.
| Compound Name | 3-N-[3-(3-aminophenyl)phenyl]-5-chloro-1-N,1-N,3-N-triphenylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 166853433 |
| Molecular Formula | C36H28ClN3 |
| Molecular Weight | 538.09 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | 3-N-[3-(3-aminophenyl)phenyl]-5-chloro-1-N,1-N,3-N-triphenylbenzene-1,3-diamine |
| SMILES | Nc1cccc(-c2cccc(N(c3ccccc3)c3cc(Cl)cc(N(c4ccccc4)c4ccccc4)c3)c2)c1 |
| InChI | InChI=1S/C36H28ClN3/c37-29-24-35(39(31-15-4-1-5-16-31)32-17-6-2-7-18-32)26-36(25-29)40(33-19-8-3-9-20-33)34-21-11-13-28(23-34)27-12-10-14-30(38)22-27/h1-26H,38H2 |
| InChIKey | SRFXJICVKZYAPH-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.09 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|