C10H12BrNO3 — CID 171869229
3-[2-(bromomethyl)phenyl]-2,3-dihydroxypropanamide (PubChem CID 171869229) has the molecular formula C10H12BrNO3 and a molecular weight of 274.11 g/mol. Its IUPAC name is 3-[2-(bromomethyl)phenyl]-2,3-dihydroxypropanamide.
| Compound Name | 3-[2-(bromomethyl)phenyl]-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171869229 |
| Molecular Formula | C10H12BrNO3 |
| Molecular Weight | 274.11 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 3-[2-(bromomethyl)phenyl]-2,3-dihydroxypropanamide |
| SMILES | NC(=O)C(O)C(O)c1ccccc1CBr |
| InChI | InChI=1S/C10H12BrNO3/c11-5-6-3-1-2-4-7(6)8(13)9(14)10(12)15/h1-4,8-9,13-14H,5H2,(H2,12,15) |
| InChIKey | SZHPFLXGTAESKH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.11 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|