C11H15N3O2 — CID 171881237
2-amino-6-(4-amino-1,2-dihydroxybutyl)benzonitrile (PubChem CID 171881237) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-amino-6-(4-amino-1,2-dihydroxybutyl)benzonitrile.
| Compound Name | 2-amino-6-(4-amino-1,2-dihydroxybutyl)benzonitrile |
|---|---|
| PubChem CID | 171881237 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-amino-6-(4-amino-1,2-dihydroxybutyl)benzonitrile |
| SMILES | N#Cc1c(N)cccc1C(O)C(O)CCN |
| InChI | InChI=1S/C11H15N3O2/c12-5-4-10(15)11(16)7-2-1-3-9(14)8(7)6-13/h1-3,10-11,15-16H,4-5,12,14H2 |
| InChIKey | DXLYXMJWVPRDNI-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 116.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|