C8H11NO4S — CID 170821322
S-[2,3-dihydroxy-3-(1,2-oxazol-4-yl)propyl] ethanethioate (PubChem CID 170821322) has the molecular formula C8H11NO4S and a molecular weight of 217.25 g/mol. Its IUPAC name is S-[2,3-dihydroxy-3-(1,2-oxazol-4-yl)propyl] ethanethioate.
| Compound Name | S-[2,3-dihydroxy-3-(1,2-oxazol-4-yl)propyl] ethanethioate |
|---|---|
| PubChem CID | 170821322 |
| Molecular Formula | C8H11NO4S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | S-[2,3-dihydroxy-3-(1,2-oxazol-4-yl)propyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1cnoc1 |
| InChI | InChI=1S/C8H11NO4S/c1-5(10)14-4-7(11)8(12)6-2-9-13-3-6/h2-3,7-8,11-12H,4H2,1H3 |
| InChIKey | BAFDPRJMIUFWIY-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|