C11H14N2O4S — CID 170821935
S-[3-(6-carbamoyl-2-pyridinyl)-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170821935) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is S-[3-(6-carbamoyl-2-pyridinyl)-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-(6-carbamoyl-2-pyridinyl)-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170821935 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | S-[3-(6-carbamoyl-2-pyridinyl)-2,3-dihydroxypropyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1cccc(C(N)=O)n1 |
| InChI | InChI=1S/C11H14N2O4S/c1-6(14)18-5-9(15)10(16)7-3-2-4-8(13-7)11(12)17/h2-4,9-10,15-16H,5H2,1H3,(H2,12,17) |
| InChIKey | TXZWTLJTGGAKOZ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|