C10H9Cl2F3N2O — CID 53405659
2-chloro-N-[2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethyl]acetamide (PubChem CID 53405659) has the molecular formula C10H9Cl2F3N2O and a molecular weight of 301.10 g/mol. Its IUPAC name is 2-chloro-N-[2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethyl]acetamide.
| Compound Name | 2-chloro-N-[2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethyl]acetamide |
|---|---|
| PubChem CID | 53405659 |
| Molecular Formula | C10H9Cl2F3N2O |
| Molecular Weight | 301.10 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 2-chloro-N-[2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]ethyl]acetamide |
| SMILES | O=C(CCl)NCCc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H9Cl2F3N2O/c11-4-9(18)16-2-1-8-7(12)3-6(5-17-8)10(13,14)15/h3,5H,1-2,4H2,(H,16,18) |
| InChIKey | SRTODSRGNZYUMV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.10 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|