C18H15ClF6N4O — CID 150869454
N'-[2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-ethoxyiminoethyl]-2-(trifluoromethyl)benzenecarboximidamide (PubChem CID 150869454) has the molecular formula C18H15ClF6N4O and a molecular weight of 452.79 g/mol. Its IUPAC name is N'-[2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-ethoxyiminoethyl]-2-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | N'-[2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-ethoxyiminoethyl]-2-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 150869454 |
| Molecular Formula | C18H15ClF6N4O |
| Molecular Weight | 452.79 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | N'-[2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-ethoxyiminoethyl]-2-(trifluoromethyl)benzenecarboximidamide |
| SMILES | CCON=C(C/N=C(\N)c1ccccc1C(F)(F)F)c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C18H15ClF6N4O/c1-2-30-29-14(15-13(19)7-10(8-27-15)17(20,21)22)9-28-16(26)11-5-3-4-6-12(11)18(23,24)25/h3-8H,2,9H2,1H3,(H2,26,28) |
| InChIKey | KTSNLRBBZBEDID-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.79 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|