C18H14ClF6N3O2 — CID 118071504
N-[(2Z)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-ethoxyiminoethyl]-2-(trifluoromethyl)benzamide (PubChem CID 118071504) has the molecular formula C18H14ClF6N3O2 and a molecular weight of 453.77 g/mol. Its IUPAC name is N-[(2Z)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-ethoxyiminoethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[(2Z)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-ethoxyiminoethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 118071504 |
| Molecular Formula | C18H14ClF6N3O2 |
| Molecular Weight | 453.77 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | N-[(2Z)-2-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-ethoxyiminoethyl]-2-(trifluoromethyl)benzamide |
| SMILES | CCO/N=C(/CNC(=O)c1ccccc1C(F)(F)F)c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C18H14ClF6N3O2/c1-2-30-28-14(15-13(19)7-10(8-26-15)17(20,21)22)9-27-16(29)11-5-3-4-6-12(11)18(23,24)25/h3-8H,2,9H2,1H3,(H,27,29)/b28-14- |
| InChIKey | YCABUXMGXHXJRC-MUXKCCDJSA-N |
| XLogP | 4.94 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.77 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|