C18H16Cl2F3N3O2 — CID 141385420
N-[(2Z)-2-(3,5-dichloro-2-pyridinyl)-2-propoxyiminoethyl]-2-(trifluoromethyl)benzamide (PubChem CID 141385420) has the molecular formula C18H16Cl2F3N3O2 and a molecular weight of 434.25 g/mol. Its IUPAC name is N-[(2Z)-2-(3,5-dichloro-2-pyridinyl)-2-propoxyiminoethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[(2Z)-2-(3,5-dichloro-2-pyridinyl)-2-propoxyiminoethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 141385420 |
| Molecular Formula | C18H16Cl2F3N3O2 |
| Molecular Weight | 434.25 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | N-[(2Z)-2-(3,5-dichloro-2-pyridinyl)-2-propoxyiminoethyl]-2-(trifluoromethyl)benzamide |
| SMILES | CCCO/N=C(/CNC(=O)c1ccccc1C(F)(F)F)c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C18H16Cl2F3N3O2/c1-2-7-28-26-15(16-14(20)8-11(19)9-24-16)10-25-17(27)12-5-3-4-6-13(12)18(21,22)23/h3-6,8-9H,2,7,10H2,1H3,(H,25,27)/b26-15- |
| InChIKey | VYJVKVXCPLMZSS-YSMPRRRNSA-N |
| XLogP | 4.97 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.25 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|