C17H22F3NO3 — CID 6424754
heptyl 2-[[2-(trifluoromethyl)benzoyl]amino]acetate (PubChem CID 6424754) has the molecular formula C17H22F3NO3 and a molecular weight of 345.36 g/mol. Its IUPAC name is heptyl 2-[[2-(trifluoromethyl)benzoyl]amino]acetate.
| Compound Name | heptyl 2-[[2-(trifluoromethyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 6424754 |
| Molecular Formula | C17H22F3NO3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | heptyl 2-[[2-(trifluoromethyl)benzoyl]amino]acetate |
| SMILES | CCCCCCCOC(=O)CNC(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H22F3NO3/c1-2-3-4-5-8-11-24-15(22)12-21-16(23)13-9-6-7-10-14(13)17(18,19)20/h6-7,9-10H,2-5,8,11-12H2,1H3,(H,21,23) |
| InChIKey | VOEQQMZIMRSGJV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|