C17H14Cl2F3N3O2 — CID 118071683
N-[(1Z)-1-(3,5-dichloro-2-pyridinyl)-1-methoxyiminopropan-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 118071683) has the molecular formula C17H14Cl2F3N3O2 and a molecular weight of 420.22 g/mol. Its IUPAC name is N-[(1Z)-1-(3,5-dichloro-2-pyridinyl)-1-methoxyiminopropan-2-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[(1Z)-1-(3,5-dichloro-2-pyridinyl)-1-methoxyiminopropan-2-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 118071683 |
| Molecular Formula | C17H14Cl2F3N3O2 |
| Molecular Weight | 420.22 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | N-[(1Z)-1-(3,5-dichloro-2-pyridinyl)-1-methoxyiminopropan-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | CO/N=C(\c1ncc(Cl)cc1Cl)C(C)NC(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H14Cl2F3N3O2/c1-9(14(25-27-2)15-13(19)7-10(18)8-23-15)24-16(26)11-5-3-4-6-12(11)17(20,21)22/h3-9H,1-2H3,(H,24,26)/b25-14- |
| InChIKey | WBIWMPHKVZAWOH-QFEZKATASA-N |
| XLogP | 4.58 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.22 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|