About N-[1-[(5,6-dichloro-3-pyridinyl)oxy]butan-2-yl]-2-(trifluoromethyl)benzamide
N-[1-[(5,6-dichloro-3-pyridinyl)oxy]butan-2-yl]-2-(trifluoromethyl)benzamide (PubChem CID 173093170) has the molecular formula C17H15Cl2F3N2O2
and a molecular weight of 407.22 g/mol. Its IUPAC name is N-[1-[(5,6-dichloro-3-pyridinyl)oxy]butan-2-yl]-2-(trifluoromethyl)benzamide.
Molecular Properties
| Compound Name | N-[1-[(5,6-dichloro-3-pyridinyl)oxy]butan-2-yl]-2-(trifluoromethyl)benzamide |
| PubChem CID | 173093170 |
| Molecular Formula | C17H15Cl2F3N2O2 |
| Molecular Weight | 407.22 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | N-[1-[(5,6-dichloro-3-pyridinyl)oxy]butan-2-yl]-2-(trifluoromethyl)benzamide |
| SMILES | CCC(COc1cnc(Cl)c(Cl)c1)NC(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H15Cl2F3N2O2/c1-2-10(9-26-11-7-14(18)15(19)23-8-11)24-16(25)12-5-3-4-6-13(12)17(20,21)22/h3-8,10H,2,9H2,1H3,(H,24,25) |
| InChIKey | ARMSNBWPBCSNGE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.22 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-[1-[(5,6-dichloro-3-pyridinyl)oxy]butan-2-yl]-2-(trifluoromethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(5,6-dichloro-3-pyridinyl)oxy]butan-2-yl]-2-(trifluoromethyl)benzamide?
The IUPAC name of N-[1-[(5,6-dichloro-3-pyridinyl)oxy]butan-2-yl]-2-(trifluoromethyl)benzamide (CID 173093170) is N-[1-[(5,6-dichloro-3-pyridinyl)oxy]butan-2-yl]-2-(trifluoromethyl)benzamide.
What is the SMILES notation for N-[1-[(5,6-dichloro-3-pyridinyl)oxy]butan-2-yl]-2-(trifluoromethyl)benzamide?
The canonical SMILES for N-[1-[(5,6-dichloro-3-pyridinyl)oxy]butan-2-yl]-2-(trifluoromethyl)benzamide is CCC(COc1cnc(Cl)c(Cl)c1)NC(=O)c1ccccc1C(F)(F)F.
What is the InChIKey of N-[1-[(5,6-dichloro-3-pyridinyl)oxy]butan-2-yl]-2-(trifluoromethyl)benzamide?
The InChIKey is ARMSNBWPBCSNGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15Cl2F3N2O2/c1-2-10(9-26-11-7-14(18)15(19)23-8-11)24-16(25)12-5-3-4-6-13(12)17(20,21)22/h3-8,10H,2,9H2,1H3,(H,24,25).
What are the key properties of N-[1-[(5,6-dichloro-3-pyridinyl)oxy]butan-2-yl]-2-(trifluoromethyl)benzamide?
N-[1-[(5,6-dichloro-3-pyridinyl)oxy]butan-2-yl]-2-(trifluoromethyl)benzamide has a molecular weight of 407.22 g/mol, XLogP of 4.99, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(5,6-dichloro-3-pyridinyl)oxy]butan-2-yl]-2-(trifluoromethyl)benzamide is sourced from PubChem (CID 173093170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).