C17H18Cl2N2O3 — CID 173092637
N-[1-[(5,6-dichloro-3-pyridinyl)oxy]butan-2-yl]-3-methoxybenzamide (PubChem CID 173092637) has the molecular formula C17H18Cl2N2O3 and a molecular weight of 369.25 g/mol. Its IUPAC name is N-[1-[(5,6-dichloro-3-pyridinyl)oxy]butan-2-yl]-3-methoxybenzamide.
| Compound Name | N-[1-[(5,6-dichloro-3-pyridinyl)oxy]butan-2-yl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 173092637 |
| Molecular Formula | C17H18Cl2N2O3 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | N-[1-[(5,6-dichloro-3-pyridinyl)oxy]butan-2-yl]-3-methoxybenzamide |
| SMILES | CCC(COc1cnc(Cl)c(Cl)c1)NC(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C17H18Cl2N2O3/c1-3-12(10-24-14-8-15(18)16(19)20-9-14)21-17(22)11-5-4-6-13(7-11)23-2/h4-9,12H,3,10H2,1-2H3,(H,21,22) |
| InChIKey | LKMSGTIPAKCTBD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|