C21H27NO5 — CID 96564662
3,4,5-trimethoxy-N-[(2S)-1-(3-methylphenoxy)butan-2-yl]benzamide (PubChem CID 96564662) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[(2S)-1-(3-methylphenoxy)butan-2-yl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[(2S)-1-(3-methylphenoxy)butan-2-yl]benzamide |
|---|---|
| PubChem CID | 96564662 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 3,4,5-trimethoxy-N-[(2S)-1-(3-methylphenoxy)butan-2-yl]benzamide |
| SMILES | CC[C@@H](COc1cccc(C)c1)NC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H27NO5/c1-6-16(13-27-17-9-7-8-14(2)10-17)22-21(23)15-11-18(24-3)20(26-5)19(12-15)25-4/h7-12,16H,6,13H2,1-5H3,(H,22,23)/t16-/m0/s1 |
| InChIKey | RDNAWSSSHUMVMI-INIZCTEOSA-N |
| XLogP | 3.61 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |