C18H15ClF3NO3 — CID 51276559
methyl 3-(2-chlorophenyl)-3-[[2-(trifluoromethyl)benzoyl]amino]propanoate (PubChem CID 51276559) has the molecular formula C18H15ClF3NO3 and a molecular weight of 385.77 g/mol. Its IUPAC name is methyl 3-(2-chlorophenyl)-3-[[2-(trifluoromethyl)benzoyl]amino]propanoate.
| Compound Name | methyl 3-(2-chlorophenyl)-3-[[2-(trifluoromethyl)benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 51276559 |
| Molecular Formula | C18H15ClF3NO3 |
| Molecular Weight | 385.77 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | methyl 3-(2-chlorophenyl)-3-[[2-(trifluoromethyl)benzoyl]amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)c1ccccc1C(F)(F)F)c1ccccc1Cl |
| InChI | InChI=1S/C18H15ClF3NO3/c1-26-16(24)10-15(12-7-3-5-9-14(12)19)23-17(25)11-6-2-4-8-13(11)18(20,21)22/h2-9,15H,10H2,1H3,(H,23,25) |
| InChIKey | WYJBOAHMKCHKFD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.77 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |