C18H18ClNO5S — CID 17440071
methyl 3-(2-chlorophenyl)-3-[(4-methylsulfonylbenzoyl)amino]propanoate (PubChem CID 17440071) has the molecular formula C18H18ClNO5S and a molecular weight of 395.86 g/mol. Its IUPAC name is methyl 3-(2-chlorophenyl)-3-[(4-methylsulfonylbenzoyl)amino]propanoate.
| Compound Name | methyl 3-(2-chlorophenyl)-3-[(4-methylsulfonylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 17440071 |
| Molecular Formula | C18H18ClNO5S |
| Molecular Weight | 395.86 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | methyl 3-(2-chlorophenyl)-3-[(4-methylsulfonylbenzoyl)amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)c1ccc(S(C)(=O)=O)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C18H18ClNO5S/c1-25-17(21)11-16(14-5-3-4-6-15(14)19)20-18(22)12-7-9-13(10-8-12)26(2,23)24/h3-10,16H,11H2,1-2H3,(H,20,22) |
| InChIKey | JAEBVFCSFWJMPG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.86 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |