C18H15ClN2O3 — CID 51256847
methyl 3-(2-chlorophenyl)-3-[(3-cyanobenzoyl)amino]propanoate (PubChem CID 51256847) has the molecular formula C18H15ClN2O3 and a molecular weight of 342.78 g/mol. Its IUPAC name is methyl 3-(2-chlorophenyl)-3-[(3-cyanobenzoyl)amino]propanoate.
| Compound Name | methyl 3-(2-chlorophenyl)-3-[(3-cyanobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 51256847 |
| Molecular Formula | C18H15ClN2O3 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | methyl 3-(2-chlorophenyl)-3-[(3-cyanobenzoyl)amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)c1cccc(C#N)c1)c1ccccc1Cl |
| InChI | InChI=1S/C18H15ClN2O3/c1-24-17(22)10-16(14-7-2-3-8-15(14)19)21-18(23)13-6-4-5-12(9-13)11-20/h2-9,16H,10H2,1H3,(H,21,23) |
| InChIKey | WFKNFIYWXAZQKO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |