C19H20ClNO3 — CID 5164713
ethyl 3-(2-chlorophenyl)-3-[(3-methylbenzoyl)amino]propanoate (PubChem CID 5164713) has the molecular formula C19H20ClNO3 and a molecular weight of 345.83 g/mol. Its IUPAC name is ethyl 3-(2-chlorophenyl)-3-[(3-methylbenzoyl)amino]propanoate.
| Compound Name | ethyl 3-(2-chlorophenyl)-3-[(3-methylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 5164713 |
| Molecular Formula | C19H20ClNO3 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | ethyl 3-(2-chlorophenyl)-3-[(3-methylbenzoyl)amino]propanoate |
| SMILES | CCOC(=O)CC(NC(=O)c1cccc(C)c1)c1ccccc1Cl |
| InChI | InChI=1S/C19H20ClNO3/c1-3-24-18(22)12-17(15-9-4-5-10-16(15)20)21-19(23)14-8-6-7-13(2)11-14/h4-11,17H,3,12H2,1-2H3,(H,21,23) |
| InChIKey | CFAYWWVIQWWBHW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |