C17H14BrClN2O5 — CID 55440642
methyl 3-[(4-bromo-3-nitrobenzoyl)amino]-3-(2-chlorophenyl)propanoate (PubChem CID 55440642) has the molecular formula C17H14BrClN2O5 and a molecular weight of 441.67 g/mol. Its IUPAC name is methyl 3-[(4-bromo-3-nitrobenzoyl)amino]-3-(2-chlorophenyl)propanoate.
| Compound Name | methyl 3-[(4-bromo-3-nitrobenzoyl)amino]-3-(2-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 55440642 |
| Molecular Formula | C17H14BrClN2O5 |
| Molecular Weight | 441.67 g/mol |
| Exact Mass | 439.98 |
| IUPAC Name | methyl 3-[(4-bromo-3-nitrobenzoyl)amino]-3-(2-chlorophenyl)propanoate |
| SMILES | COC(=O)CC(NC(=O)c1ccc(Br)c([N+](=O)[O-])c1)c1ccccc1Cl |
| InChI | InChI=1S/C17H14BrClN2O5/c1-26-16(22)9-14(11-4-2-3-5-13(11)19)20-17(23)10-6-7-12(18)15(8-10)21(24)25/h2-8,14H,9H2,1H3,(H,20,23) |
| InChIKey | LEHGRHBHDJDWBY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.67 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|