C16H12BrClF3N3O2 — CID 141385424
N-[(2Z)-2-(5-bromo-3-chloro-2-pyridinyl)-2-methoxyiminoethyl]-2-(trifluoromethyl)benzamide (PubChem CID 141385424) has the molecular formula C16H12BrClF3N3O2 and a molecular weight of 450.64 g/mol. Its IUPAC name is N-[(2Z)-2-(5-bromo-3-chloro-2-pyridinyl)-2-methoxyiminoethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[(2Z)-2-(5-bromo-3-chloro-2-pyridinyl)-2-methoxyiminoethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 141385424 |
| Molecular Formula | C16H12BrClF3N3O2 |
| Molecular Weight | 450.64 g/mol |
| Exact Mass | 448.98 |
| IUPAC Name | N-[(2Z)-2-(5-bromo-3-chloro-2-pyridinyl)-2-methoxyiminoethyl]-2-(trifluoromethyl)benzamide |
| SMILES | CO/N=C(/CNC(=O)c1ccccc1C(F)(F)F)c1ncc(Br)cc1Cl |
| InChI | InChI=1S/C16H12BrClF3N3O2/c1-26-24-13(14-12(18)6-9(17)7-22-14)8-23-15(25)10-4-2-3-5-11(10)16(19,20)21/h2-7H,8H2,1H3,(H,23,25)/b24-13- |
| InChIKey | MPYSTDVUAKZXHB-CFRMEGHHSA-N |
| XLogP | 4.30 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.64 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|