C13H8ClF3N4OS — CID 58271176
7-chloro-N-(thiophen-2-ylmethyl)-5-(trifluoromethyl)benzotriazole-1-carboxamide (PubChem CID 58271176) has the molecular formula C13H8ClF3N4OS and a molecular weight of 360.75 g/mol. Its IUPAC name is 7-chloro-N-(thiophen-2-ylmethyl)-5-(trifluoromethyl)benzotriazole-1-carboxamide.
| Compound Name | 7-chloro-N-(thiophen-2-ylmethyl)-5-(trifluoromethyl)benzotriazole-1-carboxamide |
|---|---|
| PubChem CID | 58271176 |
| Molecular Formula | C13H8ClF3N4OS |
| Molecular Weight | 360.75 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 7-chloro-N-(thiophen-2-ylmethyl)-5-(trifluoromethyl)benzotriazole-1-carboxamide |
| SMILES | O=C(NCc1cccs1)n1nnc2cc(C(F)(F)F)cc(Cl)c21 |
| InChI | InChI=1S/C13H8ClF3N4OS/c14-9-4-7(13(15,16)17)5-10-11(9)21(20-19-10)12(22)18-6-8-2-1-3-23-8/h1-5H,6H2,(H,18,22) |
| InChIKey | AMGDVLSLLFMNHD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.75 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |