C22H17N5O5S — CID 46428432
4-[2-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylanilino]-2-oxoethyl]sulfanyl-3-nitrobenzamide (PubChem CID 46428432) has the molecular formula C22H17N5O5S and a molecular weight of 463.48 g/mol. Its IUPAC name is 4-[2-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylanilino]-2-oxoethyl]sulfanyl-3-nitrobenzamide.
| Compound Name | 4-[2-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylanilino]-2-oxoethyl]sulfanyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 46428432 |
| Molecular Formula | C22H17N5O5S |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 4-[2-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylanilino]-2-oxoethyl]sulfanyl-3-nitrobenzamide |
| SMILES | Cc1cc(Oc2ncccc2C#N)ccc1NC(=O)CSc1ccc(C(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H17N5O5S/c1-13-9-16(32-22-15(11-23)3-2-8-25-22)5-6-17(13)26-20(28)12-33-19-7-4-14(21(24)29)10-18(19)27(30)31/h2-10H,12H2,1H3,(H2,24,29)(H,26,28) |
| InChIKey | VLTZWIZLLIDASF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 161.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|