C22H18N4O4S — CID 46485378
N-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylphenyl]-2-(4-nitrophenyl)sulfanylpropanamide (PubChem CID 46485378) has the molecular formula C22H18N4O4S and a molecular weight of 434.48 g/mol. Its IUPAC name is N-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylphenyl]-2-(4-nitrophenyl)sulfanylpropanamide.
| Compound Name | N-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylphenyl]-2-(4-nitrophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 46485378 |
| Molecular Formula | C22H18N4O4S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | N-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylphenyl]-2-(4-nitrophenyl)sulfanylpropanamide |
| SMILES | Cc1cc(Oc2ncccc2C#N)ccc1NC(=O)C(C)Sc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H18N4O4S/c1-14-12-18(30-22-16(13-23)4-3-11-24-22)7-10-20(14)25-21(27)15(2)31-19-8-5-17(6-9-19)26(28)29/h3-12,15H,1-2H3,(H,25,27) |
| InChIKey | QMHASEIOQYVSCO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 118.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|