C25H23N5O4 — CID 55763880
N-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylphenyl]-1-(2-nitrophenyl)piperidine-4-carboxamide (PubChem CID 55763880) has the molecular formula C25H23N5O4 and a molecular weight of 457.49 g/mol. Its IUPAC name is N-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylphenyl]-1-(2-nitrophenyl)piperidine-4-carboxamide.
| Compound Name | N-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylphenyl]-1-(2-nitrophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55763880 |
| Molecular Formula | C25H23N5O4 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | N-[4-[(3-cyano-2-pyridinyl)oxy]-2-methylphenyl]-1-(2-nitrophenyl)piperidine-4-carboxamide |
| SMILES | Cc1cc(Oc2ncccc2C#N)ccc1NC(=O)C1CCN(c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C25H23N5O4/c1-17-15-20(34-25-19(16-26)5-4-12-27-25)8-9-21(17)28-24(31)18-10-13-29(14-11-18)22-6-2-3-7-23(22)30(32)33/h2-9,12,15,18H,10-11,13-14H2,1H3,(H,28,31) |
| InChIKey | ZTFMTIGOPMEVME-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 121.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|