C22H18F3N3O5S — CID 55643271
N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide (PubChem CID 55643271) has the molecular formula C22H18F3N3O5S and a molecular weight of 493.46 g/mol. Its IUPAC name is N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide.
| Compound Name | N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 55643271 |
| Molecular Formula | C22H18F3N3O5S |
| Molecular Weight | 493.46 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylacetamide |
| SMILES | COc1ccc(NC(=O)CSc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cc1OCc1cccnc1 |
| InChI | InChI=1S/C22H18F3N3O5S/c1-32-18-6-5-16(10-19(18)33-12-14-3-2-8-26-11-14)27-21(29)13-34-20-7-4-15(22(23,24)25)9-17(20)28(30)31/h2-11H,12-13H2,1H3,(H,27,29) |
| InChIKey | GRBVSPVNWLUWRC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|