C16H10F6N2O5S2 — CID 40739649
2-[2-nitro-4-[(S)-trifluoromethylsulfinyl]phenoxy]-N-[3-(trifluoromethylsulfanyl)phenyl]acetamide (PubChem CID 40739649) has the molecular formula C16H10F6N2O5S2 and a molecular weight of 488.39 g/mol. Its IUPAC name is 2-[2-nitro-4-[(S)-trifluoromethylsulfinyl]phenoxy]-N-[3-(trifluoromethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-[2-nitro-4-[(S)-trifluoromethylsulfinyl]phenoxy]-N-[3-(trifluoromethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 40739649 |
| Molecular Formula | C16H10F6N2O5S2 |
| Molecular Weight | 488.39 g/mol |
| Exact Mass | 487.99 |
| IUPAC Name | 2-[2-nitro-4-[(S)-trifluoromethylsulfinyl]phenoxy]-N-[3-(trifluoromethylsulfanyl)phenyl]acetamide |
| SMILES | O=C(COc1ccc([S@](=O)C(F)(F)F)cc1[N+](=O)[O-])Nc1cccc(SC(F)(F)F)c1 |
| InChI | InChI=1S/C16H10F6N2O5S2/c17-15(18,19)30-10-3-1-2-9(6-10)23-14(25)8-29-13-5-4-11(7-12(13)24(26)27)31(28)16(20,21)22/h1-7H,8H2,(H,23,25)/t31-/m0/s1 |
| InChIKey | PQXFBJUEVAOFII-HKBQPEDESA-N |
| XLogP | 4.85 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|