C13H16N2O7S3 — CID 21206371
N-(1,1-dioxothiolan-3-yl)-2-(4-methylsulfinyl-2-nitrophenyl)sulfinylacetamide (PubChem CID 21206371) has the molecular formula C13H16N2O7S3 and a molecular weight of 408.48 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(4-methylsulfinyl-2-nitrophenyl)sulfinylacetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(4-methylsulfinyl-2-nitrophenyl)sulfinylacetamide |
|---|---|
| PubChem CID | 21206371 |
| Molecular Formula | C13H16N2O7S3 |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(4-methylsulfinyl-2-nitrophenyl)sulfinylacetamide |
| SMILES | CS(=O)c1ccc(S(=O)CC(=O)NC2CCS(=O)(=O)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H16N2O7S3/c1-23(19)10-2-3-12(11(6-10)15(17)18)24(20)7-13(16)14-9-4-5-25(21,22)8-9/h2-3,6,9H,4-5,7-8H2,1H3,(H,14,16) |
| InChIKey | MXUSTHHPBSWJLZ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 140.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|