C24H24N4O5S — CID 2897373
N-(4-nitrophenyl)-N-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]benzenesulfonamide (PubChem CID 2897373) has the molecular formula C24H24N4O5S and a molecular weight of 480.55 g/mol. Its IUPAC name is N-(4-nitrophenyl)-N-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]benzenesulfonamide.
| Compound Name | N-(4-nitrophenyl)-N-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2897373 |
| Molecular Formula | C24H24N4O5S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | N-(4-nitrophenyl)-N-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]benzenesulfonamide |
| SMILES | O=C(CN(c1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccccc1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H24N4O5S/c29-24(26-17-15-25(16-18-26)20-7-3-1-4-8-20)19-27(21-11-13-22(14-12-21)28(30)31)34(32,33)23-9-5-2-6-10-23/h1-14H,15-19H2 |
| InChIKey | PFCSIFKRUHEFJW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|