C24H23FN4O5S — CID 1003128
N-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-N-(3-nitrophenyl)benzenesulfonamide (PubChem CID 1003128) has the molecular formula C24H23FN4O5S and a molecular weight of 498.54 g/mol. Its IUPAC name is N-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-N-(3-nitrophenyl)benzenesulfonamide.
| Compound Name | N-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-N-(3-nitrophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 1003128 |
| Molecular Formula | C24H23FN4O5S |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | N-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-N-(3-nitrophenyl)benzenesulfonamide |
| SMILES | O=C(CN(c1cccc([N+](=O)[O-])c1)S(=O)(=O)c1ccccc1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C24H23FN4O5S/c25-22-11-4-5-12-23(22)26-13-15-27(16-14-26)24(30)18-28(19-7-6-8-20(17-19)29(31)32)35(33,34)21-9-2-1-3-10-21/h1-12,17H,13-16,18H2 |
| InChIKey | WBABKZXOOOXJBW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|