C18H29N3O3 — CID 124844307
1-[(2R,5S)-2,5-diethyl-4-(2-nitrophenyl)piperazin-1-yl]-2-methylpropan-2-ol (PubChem CID 124844307) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-[(2R,5S)-2,5-diethyl-4-(2-nitrophenyl)piperazin-1-yl]-2-methylpropan-2-ol.
| Compound Name | 1-[(2R,5S)-2,5-diethyl-4-(2-nitrophenyl)piperazin-1-yl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 124844307 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 1-[(2R,5S)-2,5-diethyl-4-(2-nitrophenyl)piperazin-1-yl]-2-methylpropan-2-ol |
| SMILES | CC[C@@H]1CN(c2ccccc2[N+](=O)[O-])[C@@H](CC)CN1CC(C)(C)O |
| InChI | InChI=1S/C18H29N3O3/c1-5-14-12-20(16-9-7-8-10-17(16)21(23)24)15(6-2)11-19(14)13-18(3,4)22/h7-10,14-15,22H,5-6,11-13H2,1-4H3/t14-,15+/m1/s1 |
| InChIKey | FZNKKYXOZHCMJN-CABCVRRESA-N |
| XLogP | 3.04 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|