C20H25N3O3 — CID 56955230
(1R,2S,3S,6R,7S)-N-tert-butyl-4-(2-nitrophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxamide (PubChem CID 56955230) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is (1R,2S,3S,6R,7S)-N-tert-butyl-4-(2-nitrophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxamide.
| Compound Name | (1R,2S,3S,6R,7S)-N-tert-butyl-4-(2-nitrophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxamide |
|---|---|
| PubChem CID | 56955230 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (1R,2S,3S,6R,7S)-N-tert-butyl-4-(2-nitrophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@@H]1[C@@H]2[C@H](CN1c1ccccc1[N+](=O)[O-])[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C20H25N3O3/c1-20(2,3)21-19(24)18-17-13-9-8-12(10-13)14(17)11-22(18)15-6-4-5-7-16(15)23(25)26/h4-9,12-14,17-18H,10-11H2,1-3H3,(H,21,24)/t12-,13+,14-,17+,18+/m1/s1 |
| InChIKey | WTZULDZESKJUSS-OSARJHGOSA-N |
| XLogP | 3.14 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|