C17H23N3O3 — CID 56954549
(3S,3aS,6aR)-2-(2-nitrophenyl)-N-propan-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 56954549) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is (3S,3aS,6aR)-2-(2-nitrophenyl)-N-propan-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | (3S,3aS,6aR)-2-(2-nitrophenyl)-N-propan-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 56954549 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | (3S,3aS,6aR)-2-(2-nitrophenyl)-N-propan-2-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | CC(C)NC(=O)[C@@H]1[C@H]2CCC[C@H]2CN1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H23N3O3/c1-11(2)18-17(21)16-13-7-5-6-12(13)10-19(16)14-8-3-4-9-15(14)20(22)23/h3-4,8-9,11-13,16H,5-7,10H2,1-2H3,(H,18,21)/t12-,13-,16-/m0/s1 |
| InChIKey | HKJYGTSYDDEYPB-XEZPLFJOSA-N |
| XLogP | 2.72 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|