C22H27N3O3 — CID 17499311
1-(2-nitrophenyl)-N-(1-phenylbutyl)piperidine-4-carboxamide (PubChem CID 17499311) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 1-(2-nitrophenyl)-N-(1-phenylbutyl)piperidine-4-carboxamide.
| Compound Name | 1-(2-nitrophenyl)-N-(1-phenylbutyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17499311 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 1-(2-nitrophenyl)-N-(1-phenylbutyl)piperidine-4-carboxamide |
| SMILES | CCCC(NC(=O)C1CCN(c2ccccc2[N+](=O)[O-])CC1)c1ccccc1 |
| InChI | InChI=1S/C22H27N3O3/c1-2-8-19(17-9-4-3-5-10-17)23-22(26)18-13-15-24(16-14-18)20-11-6-7-12-21(20)25(27)28/h3-7,9-12,18-19H,2,8,13-16H2,1H3,(H,23,26) |
| InChIKey | GNKOFCZRWVSKGZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|